C17H14F3NO — CID 102291699
4,4-dimethyl-2-[4-(trifluoromethyl)phenyl]-3,1-benzoxazine (PubChem CID 102291699) has the molecular formula C17H14F3NO and a molecular weight of 305.30 g/mol. Its IUPAC name is 4,4-dimethyl-2-[4-(trifluoromethyl)phenyl]-3,1-benzoxazine.
| Compound Name | 4,4-dimethyl-2-[4-(trifluoromethyl)phenyl]-3,1-benzoxazine |
|---|---|
| PubChem CID | 102291699 |
| Molecular Formula | C17H14F3NO |
| Molecular Weight | 305.30 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | 4,4-dimethyl-2-[4-(trifluoromethyl)phenyl]-3,1-benzoxazine |
| SMILES | CC1(C)OC(c2ccc(C(F)(F)F)cc2)=Nc2ccccc21 |
| InChI | InChI=1S/C17H14F3NO/c1-16(2)13-5-3-4-6-14(13)21-15(22-16)11-7-9-12(10-8-11)17(18,19)20/h3-10H,1-2H3 |
| InChIKey | KHRRUBFHCKWIDO-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.30 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |