C18H34O4Si2 — CID 102291835
dimethyl 2-[(2E,5Z)-5,6-bis(trimethylsilyl)hepta-2,5-dienyl]propanedioate (PubChem CID 102291835) has the molecular formula C18H34O4Si2 and a molecular weight of 370.64 g/mol. Its IUPAC name is dimethyl 2-[(2E,5Z)-5,6-bis(trimethylsilyl)hepta-2,5-dienyl]propanedioate.
| Compound Name | dimethyl 2-[(2E,5Z)-5,6-bis(trimethylsilyl)hepta-2,5-dienyl]propanedioate |
|---|---|
| PubChem CID | 102291835 |
| Molecular Formula | C18H34O4Si2 |
| Molecular Weight | 370.64 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | dimethyl 2-[(2E,5Z)-5,6-bis(trimethylsilyl)hepta-2,5-dienyl]propanedioate |
| SMILES | COC(=O)C(C/C=C/C/C(=C(\C)[Si](C)(C)C)[Si](C)(C)C)C(=O)OC |
| InChI | InChI=1S/C18H34O4Si2/c1-14(23(4,5)6)16(24(7,8)9)13-11-10-12-15(17(19)21-2)18(20)22-3/h10-11,15H,12-13H2,1-9H3/b11-10+,16-14- |
| InChIKey | FAYFNLVKVOKWSY-LNCFZFMDSA-N |
| XLogP | 4.36 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.64 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|