C20H38O3Si — CID 102291863
[(2R,4S,6S)-2-[(Z)-2-butoxyethenyl]-6-ethenyl-4-methyloxan-4-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 102291863) has the molecular formula C20H38O3Si and a molecular weight of 354.61 g/mol. Its IUPAC name is [(2R,4S,6S)-2-[(Z)-2-butoxyethenyl]-6-ethenyl-4-methyloxan-4-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(2R,4S,6S)-2-[(Z)-2-butoxyethenyl]-6-ethenyl-4-methyloxan-4-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 102291863 |
| Molecular Formula | C20H38O3Si |
| Molecular Weight | 354.61 g/mol |
| Exact Mass | 354.26 |
| IUPAC Name | [(2R,4S,6S)-2-[(Z)-2-butoxyethenyl]-6-ethenyl-4-methyloxan-4-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | C=C[C@@H]1C[C@](C)(O[Si](C)(C)C(C)(C)C)C[C@H](/C=C\OCCCC)O1 |
| InChI | InChI=1S/C20H38O3Si/c1-9-11-13-21-14-12-18-16-20(6,15-17(10-2)22-18)23-24(7,8)19(3,4)5/h10,12,14,17-18H,2,9,11,13,15-16H2,1,3-8H3/b14-12-/t17-,18+,20+/m1/s1 |
| InChIKey | IFWDAMORRCVYSD-AFCDGMDYSA-N |
| XLogP | 5.83 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.61 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|