C20H16BF10N — CID 102291936
1,1-bis(2,3,4,5,6-pentafluorophenyl)-5-azonia-1-boranuidaspiro[4.5]decane (PubChem CID 102291936) has the molecular formula C20H16BF10N and a molecular weight of 471.15 g/mol. Its IUPAC name is 1,1-bis(2,3,4,5,6-pentafluorophenyl)-5-azonia-1-boranuidaspiro[4.5]decane.
| Compound Name | 1,1-bis(2,3,4,5,6-pentafluorophenyl)-5-azonia-1-boranuidaspiro[4.5]decane |
|---|---|
| PubChem CID | 102291936 |
| Molecular Formula | C20H16BF10N |
| Molecular Weight | 471.15 g/mol |
| Exact Mass | 471.12 |
| IUPAC Name | 1,1-bis(2,3,4,5,6-pentafluorophenyl)-5-azonia-1-boranuidaspiro[4.5]decane |
| SMILES | Fc1c(F)c(F)c([B-]2(c3c(F)c(F)c(F)c(F)c3F)CCC[N+]23CCCCC3)c(F)c1F |
| InChI | InChI=1S/C20H16BF10N/c22-11-9(12(23)16(27)19(30)15(11)26)21(5-4-8-32(21)6-2-1-3-7-32)10-13(24)17(28)20(31)18(29)14(10)25/h1-8H2 |
| InChIKey | HJIBNAVGACQSPD-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.15 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|