C19H29FN4O11 — CID 10229208
(2S,3R,4R)-4-[[amino-(2-butanoyloxyethoxycarbonylamino)methylidene]amino]-2-[(2R)-1-fluoro-2,3-dihydroxypropyl]-3-(methoxycarbonylamino)-3,4-dihydro-2H-pyran-6-carboxylic acid (PubChem CID 10229208) has the molecular formula C19H29FN4O11 and a molecular weight of 508.46 g/mol. Its IUPAC name is (2S,3R,4R)-4-[[amino-(2-butanoyloxyethoxycarbonylamino)methylidene]amino]-2-[(2R)-1-fluoro-2,3-dihydroxypropyl]-3-(methoxycarbonylamino)-3,4-dihydro-2H-pyran-6-carboxylic acid.
| Compound Name | (2S,3R,4R)-4-[[amino-(2-butanoyloxyethoxycarbonylamino)methylidene]amino]-2-[(2R)-1-fluoro-2,3-dihydroxypropyl]-3-(methoxycarbonylamino)-3,4-dihydro-2H-pyran-6-carboxylic acid |
|---|---|
| PubChem CID | 10229208 |
| Molecular Formula | C19H29FN4O11 |
| Molecular Weight | 508.46 g/mol |
| Exact Mass | 508.18 |
| IUPAC Name | (2S,3R,4R)-4-[[amino-(2-butanoyloxyethoxycarbonylamino)methylidene]amino]-2-[(2R)-1-fluoro-2,3-dihydroxypropyl]-3-(methoxycarbonylamino)-3,4-dihydro-2H-pyran-6-carboxylic acid |
| SMILES | CCCC(=O)OCCOC(=O)N/C(N)=N/[C@@H]1C=C(C(=O)O)O[C@H](C(F)[C@H](O)CO)[C@@H]1NC(=O)OC |
| InChI | InChI=1S/C19H29FN4O11/c1-3-4-12(27)33-5-6-34-19(31)24-17(21)22-9-7-11(16(28)29)35-15(13(20)10(26)8-25)14(9)23-18(30)32-2/h7,9-10,13-15,25-26H,3-6,8H2,1-2H3,(H,23,30)(H,28,29)(H3,21,22,24,31)/t9-,10-,13?,14-,15-/m1/s1 |
| InChIKey | RUEROQSMNGWNMY-HYWLJIBOSA-N |
| XLogP | -1.48 |
| TPSA | 228.33 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.46 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|