C37H39N5O2 — CID 102292318
1-[12-[2-[4-(dimethylamino)phenyl]ethynyl]-20-methoxy-7,7,17,17-tetramethyl-8,18,21,23-tetrahydroporphyrin-2-yl]ethanone (PubChem CID 102292318) has the molecular formula C37H39N5O2 and a molecular weight of 585.75 g/mol. Its IUPAC name is 1-[12-[2-[4-(dimethylamino)phenyl]ethynyl]-20-methoxy-7,7,17,17-tetramethyl-8,18,21,23-tetrahydroporphyrin-2-yl]ethanone.
| Compound Name | 1-[12-[2-[4-(dimethylamino)phenyl]ethynyl]-20-methoxy-7,7,17,17-tetramethyl-8,18,21,23-tetrahydroporphyrin-2-yl]ethanone |
|---|---|
| PubChem CID | 102292318 |
| Molecular Formula | C37H39N5O2 |
| Molecular Weight | 585.75 g/mol |
| Exact Mass | 585.31 |
| IUPAC Name | 1-[12-[2-[4-(dimethylamino)phenyl]ethynyl]-20-methoxy-7,7,17,17-tetramethyl-8,18,21,23-tetrahydroporphyrin-2-yl]ethanone |
| SMILES | COc1c2nc(cc3cc(C#Cc4ccc(N(C)C)cc4)c(cc4nc(cc5cc(C(C)=O)c1[nH]5)C(C)(C)C4)[nH]3)C(C)(C)C2 |
| InChI | InChI=1S/C37H39N5O2/c1-22(43)29-16-26-19-32-36(2,3)20-27(39-32)17-30-24(12-9-23-10-13-28(14-11-23)42(6)7)15-25(38-30)18-33-37(4,5)21-31(41-33)35(44-8)34(29)40-26/h10-11,13-19,38,40H,20-21H2,1-8H3/b25-18-,26-19-,27-17-,30-17-,32-19-,33-18-,35-31+,35-34+ |
| InChIKey | XRBAKSSOQKGLSW-VRVUWOQKSA-N |
| XLogP | 7.03 |
| TPSA | 86.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.75 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|