C21H26O8 — CID 102292981
tetramethyl (3aS,5aS)-5-methylidene-3,3a,4,5a,6,8-hexahydro-1H-as-indacene-2,2,7,7-tetracarboxylate (PubChem CID 102292981) has the molecular formula C21H26O8 and a molecular weight of 406.43 g/mol. Its IUPAC name is tetramethyl (3aS,5aS)-5-methylidene-3,3a,4,5a,6,8-hexahydro-1H-as-indacene-2,2,7,7-tetracarboxylate.
| Compound Name | tetramethyl (3aS,5aS)-5-methylidene-3,3a,4,5a,6,8-hexahydro-1H-as-indacene-2,2,7,7-tetracarboxylate |
|---|---|
| PubChem CID | 102292981 |
| Molecular Formula | C21H26O8 |
| Molecular Weight | 406.43 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | tetramethyl (3aS,5aS)-5-methylidene-3,3a,4,5a,6,8-hexahydro-1H-as-indacene-2,2,7,7-tetracarboxylate |
| SMILES | C=C1C[C@H]2CC(C(=O)OC)(C(=O)OC)CC2=C2CC(C(=O)OC)(C(=O)OC)C[C@@H]12 |
| InChI | InChI=1S/C21H26O8/c1-11-6-12-7-20(16(22)26-2,17(23)27-3)9-14(12)15-10-21(8-13(11)15,18(24)28-4)19(25)29-5/h12-13H,1,6-10H2,2-5H3/t12-,13-/m0/s1 |
| InChIKey | DGWCKWVHQRPIQF-STQMWFEESA-N |
| XLogP | 1.73 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.43 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|