C25H23IN2O2 — CID 10229307
methyl 3-(8,20-dimethyl-8-aza-20-azoniapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-1(21),2,4,6,9,11,13,15,17,19-decaen-16-yl)propanoate iodide (PubChem CID 10229307) has the molecular formula C25H23IN2O2 and a molecular weight of 510.38 g/mol. Its IUPAC name is methyl 3-(8,20-dimethyl-8-aza-20-azoniapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-1(21),2,4,6,9,11,13,15,17,19-decaen-16-yl)propanoate iodide.
| Compound Name | methyl 3-(8,20-dimethyl-8-aza-20-azoniapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-1(21),2,4,6,9,11,13,15,17,19-decaen-16-yl)propanoate iodide |
|---|---|
| PubChem CID | 10229307 |
| Molecular Formula | C25H23IN2O2 |
| Molecular Weight | 510.38 g/mol |
| Exact Mass | 510.08 |
| IUPAC Name | methyl 3-(8,20-dimethyl-8-aza-20-azoniapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-1(21),2,4,6,9,11,13,15,17,19-decaen-16-yl)propanoate iodide |
| SMILES | COC(=O)CCc1ccc2c(c1)c1cccc3c1c([n+]2C)-c1ccccc1N3C.[I-] |
| InChI | InChI=1S/C25H23N2O2.HI/c1-26-20-9-5-4-7-18(20)25-24-17(8-6-10-22(24)26)19-15-16(12-14-23(28)29-3)11-13-21(19)27(25)2;/h4-11,13,15H,12,14H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | YNQZIYFVTPNUQM-UHFFFAOYSA-M |
| XLogP | 1.68 |
| TPSA | 33.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.38 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|