C33H26N4O4 — CID 102293315
methyl 2-[9-(furan-3-yl)-1,8-diazatetracyclo[8.6.1.02,7.014,17]heptadeca-2,4,6,10,12,14(17)-hexaen-3-yl]-1-(furan-2-ylmethyl)benzimidazole-5-carboxylate (PubChem CID 102293315) has the molecular formula C33H26N4O4 and a molecular weight of 542.60 g/mol. Its IUPAC name is methyl 2-[9-(furan-3-yl)-1,8-diazatetracyclo[8.6.1.02,7.014,17]heptadeca-2,4,6,10,12,14(17)-hexaen-3-yl]-1-(furan-2-ylmethyl)benzimidazole-5-carboxylate.
| Compound Name | methyl 2-[9-(furan-3-yl)-1,8-diazatetracyclo[8.6.1.02,7.014,17]heptadeca-2,4,6,10,12,14(17)-hexaen-3-yl]-1-(furan-2-ylmethyl)benzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 102293315 |
| Molecular Formula | C33H26N4O4 |
| Molecular Weight | 542.60 g/mol |
| Exact Mass | 542.20 |
| IUPAC Name | methyl 2-[9-(furan-3-yl)-1,8-diazatetracyclo[8.6.1.02,7.014,17]heptadeca-2,4,6,10,12,14(17)-hexaen-3-yl]-1-(furan-2-ylmethyl)benzimidazole-5-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)nc(-c1cccc3c1N1CCc4cccc(c41)C(c1ccoc1)N3)n2Cc1ccco1 |
| InChI | InChI=1S/C33H26N4O4/c1-39-33(38)21-10-11-28-27(17-21)35-32(37(28)18-23-6-4-15-41-23)25-8-3-9-26-31(25)36-14-12-20-5-2-7-24(30(20)36)29(34-26)22-13-16-40-19-22/h2-11,13,15-17,19,29,34H,12,14,18H2,1H3 |
| InChIKey | YHZVFRQWKDJELE-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 85.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.60 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |