C35H29N5O5 — CID 102293324
methyl 1-cycloheptyl-2-[6-(5-nitrofuran-2-yl)indolo[1,2-a]quinoxalin-1-yl]benzimidazole-5-carboxylate (PubChem CID 102293324) has the molecular formula C35H29N5O5 and a molecular weight of 599.65 g/mol. Its IUPAC name is methyl 1-cycloheptyl-2-[6-(5-nitrofuran-2-yl)indolo[1,2-a]quinoxalin-1-yl]benzimidazole-5-carboxylate.
| Compound Name | methyl 1-cycloheptyl-2-[6-(5-nitrofuran-2-yl)indolo[1,2-a]quinoxalin-1-yl]benzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 102293324 |
| Molecular Formula | C35H29N5O5 |
| Molecular Weight | 599.65 g/mol |
| Exact Mass | 599.22 |
| IUPAC Name | methyl 1-cycloheptyl-2-[6-(5-nitrofuran-2-yl)indolo[1,2-a]quinoxalin-1-yl]benzimidazole-5-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)nc(-c1cccc3nc(-c4ccc([N+](=O)[O-])o4)c4cc5ccccc5n4c13)n2C1CCCCCC1 |
| InChI | InChI=1S/C35H29N5O5/c1-44-35(41)22-15-16-28-26(19-22)37-34(38(28)23-10-4-2-3-5-11-23)24-12-8-13-25-33(24)39-27-14-7-6-9-21(27)20-29(39)32(36-25)30-17-18-31(45-30)40(42)43/h6-9,12-20,23H,2-5,10-11H2,1H3 |
| InChIKey | KUORCYNRFQDTNZ-UHFFFAOYSA-N |
| XLogP | 8.51 |
| TPSA | 117.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.65 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|