C32H38O2Si2 — CID 10229352
trimethyl-(1,1,2,2-tetraphenyl-2-trimethylsilyloxyethoxy)silane (PubChem CID 10229352) has the molecular formula C32H38O2Si2 and a molecular weight of 510.83 g/mol. Its IUPAC name is trimethyl-(1,1,2,2-tetraphenyl-2-trimethylsilyloxyethoxy)silane.
| Compound Name | trimethyl-(1,1,2,2-tetraphenyl-2-trimethylsilyloxyethoxy)silane |
|---|---|
| PubChem CID | 10229352 |
| Molecular Formula | C32H38O2Si2 |
| Molecular Weight | 510.83 g/mol |
| Exact Mass | 510.24 |
| IUPAC Name | trimethyl-(1,1,2,2-tetraphenyl-2-trimethylsilyloxyethoxy)silane |
| SMILES | C[Si](C)(C)OC(c1ccccc1)(c1ccccc1)C(O[Si](C)(C)C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H38O2Si2/c1-35(2,3)33-31(27-19-11-7-12-20-27,28-21-13-8-14-22-28)32(34-36(4,5)6,29-23-15-9-16-24-29)30-25-17-10-18-26-30/h7-26H,1-6H3 |
| InChIKey | WTKVMIIQXATOJO-UHFFFAOYSA-N |
| XLogP | 8.58 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.83 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|