C34H45N3O — CID 10229401
N-[1-(3-methylbutyl)piperidin-4-yl]-4-pentyl-N-[(4-pyridin-3-ylphenyl)methyl]benzamide (PubChem CID 10229401) has the molecular formula C34H45N3O and a molecular weight of 511.75 g/mol. Its IUPAC name is N-[1-(3-methylbutyl)piperidin-4-yl]-4-pentyl-N-[(4-pyridin-3-ylphenyl)methyl]benzamide.
| Compound Name | N-[1-(3-methylbutyl)piperidin-4-yl]-4-pentyl-N-[(4-pyridin-3-ylphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 10229401 |
| Molecular Formula | C34H45N3O |
| Molecular Weight | 511.75 g/mol |
| Exact Mass | 511.36 |
| IUPAC Name | N-[1-(3-methylbutyl)piperidin-4-yl]-4-pentyl-N-[(4-pyridin-3-ylphenyl)methyl]benzamide |
| SMILES | CCCCCc1ccc(C(=O)N(Cc2ccc(-c3cccnc3)cc2)C2CCN(CCC(C)C)CC2)cc1 |
| InChI | InChI=1S/C34H45N3O/c1-4-5-6-8-28-10-16-31(17-11-28)34(38)37(33-19-23-36(24-20-33)22-18-27(2)3)26-29-12-14-30(15-13-29)32-9-7-21-35-25-32/h7,9-17,21,25,27,33H,4-6,8,18-20,22-24,26H2,1-3H3 |
| InChIKey | BECDITWNSOMCMA-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.75 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|