C23H20N2O2 — CID 102294219
[(6aS,12aR)-2-methyl-5,6,6a,12a-tetrahydroquinolino[3,4-b][1,4]benzoxazin-12-yl]-phenylmethanone (PubChem CID 102294219) has the molecular formula C23H20N2O2 and a molecular weight of 356.43 g/mol. Its IUPAC name is [(6aS,12aR)-2-methyl-5,6,6a,12a-tetrahydroquinolino[3,4-b][1,4]benzoxazin-12-yl]-phenylmethanone.
| Compound Name | [(6aS,12aR)-2-methyl-5,6,6a,12a-tetrahydroquinolino[3,4-b][1,4]benzoxazin-12-yl]-phenylmethanone |
|---|---|
| PubChem CID | 102294219 |
| Molecular Formula | C23H20N2O2 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | [(6aS,12aR)-2-methyl-5,6,6a,12a-tetrahydroquinolino[3,4-b][1,4]benzoxazin-12-yl]-phenylmethanone |
| SMILES | Cc1ccc2c(c1)[C@@H]1[C@H](CN2)Oc2ccccc2N1C(=O)c1ccccc1 |
| InChI | InChI=1S/C23H20N2O2/c1-15-11-12-18-17(13-15)22-21(14-24-18)27-20-10-6-5-9-19(20)25(22)23(26)16-7-3-2-4-8-16/h2-13,21-22,24H,14H2,1H3/t21-,22+/m0/s1 |
| InChIKey | VUGWLIGXIOPKIZ-FCHUYYIVSA-N |
| XLogP | 4.57 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |