C12H18O4 — CID 102294597
methyl (3aR,6aS)-3,3,3a-trimethyl-1-oxo-5,6-dihydro-4H-cyclopenta[c]furan-6a-carboxylate (PubChem CID 102294597) has the molecular formula C12H18O4 and a molecular weight of 226.27 g/mol. Its IUPAC name is methyl (3aR,6aS)-3,3,3a-trimethyl-1-oxo-5,6-dihydro-4H-cyclopenta[c]furan-6a-carboxylate.
| Compound Name | methyl (3aR,6aS)-3,3,3a-trimethyl-1-oxo-5,6-dihydro-4H-cyclopenta[c]furan-6a-carboxylate |
|---|---|
| PubChem CID | 102294597 |
| Molecular Formula | C12H18O4 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | methyl (3aR,6aS)-3,3,3a-trimethyl-1-oxo-5,6-dihydro-4H-cyclopenta[c]furan-6a-carboxylate |
| SMILES | COC(=O)[C@]12CCC[C@@]1(C)C(C)(C)OC2=O |
| InChI | InChI=1S/C12H18O4/c1-10(2)11(3)6-5-7-12(11,8(13)15-4)9(14)16-10/h5-7H2,1-4H3/t11-,12-/m0/s1 |
| InChIKey | QWWYYAJDHKDINY-RYUDHWBXSA-N |
| XLogP | 1.67 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|