C58H68N2O2S4 — CID 102294692
2,5-dihexyl-1,4-bis[4-[5-(5-hexylthiophen-2-yl)thiophen-2-yl]phenyl]pyrrolo[3,4-c]pyrrole-3,6-dione (PubChem CID 102294692) has the molecular formula C58H68N2O2S4 and a molecular weight of 953.46 g/mol. Its IUPAC name is 2,5-dihexyl-1,4-bis[4-[5-(5-hexylthiophen-2-yl)thiophen-2-yl]phenyl]pyrrolo[3,4-c]pyrrole-3,6-dione.
| Compound Name | 2,5-dihexyl-1,4-bis[4-[5-(5-hexylthiophen-2-yl)thiophen-2-yl]phenyl]pyrrolo[3,4-c]pyrrole-3,6-dione |
|---|---|
| PubChem CID | 102294692 |
| Molecular Formula | C58H68N2O2S4 |
| Molecular Weight | 953.46 g/mol |
| Exact Mass | 952.42 |
| IUPAC Name | 2,5-dihexyl-1,4-bis[4-[5-(5-hexylthiophen-2-yl)thiophen-2-yl]phenyl]pyrrolo[3,4-c]pyrrole-3,6-dione |
| SMILES | CCCCCCc1ccc(-c2ccc(-c3ccc(C4=C5C(=O)N(CCCCCC)C(c6ccc(-c7ccc(-c8ccc(CCCCCC)s8)s7)cc6)=C5C(=O)N4CCCCCC)cc3)s2)s1 |
| InChI | InChI=1S/C58H68N2O2S4/c1-5-9-13-17-21-45-31-33-49(63-45)51-37-35-47(65-51)41-23-27-43(28-24-41)55-53-54(58(62)59(55)39-19-15-11-7-3)56(60(57(53)61)40-20-16-12-8-4)44-29-25-42(26-30-44)48-36-38-52(66-48)50-34-32-46(64-50)22-18-14-10-6-2/h23-38H,5-22,39-40H2,1-4H3 |
| InChIKey | LESMFASVAFLAPT-UHFFFAOYSA-N |
| XLogP | 17.81 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 953.46 |
| LogP ≤ 5 | 17.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|