C19H24O4 — CID 102294970
1-[(1R,5S)-10-hydroxy-1,6,6-trimethyl-7,16-dioxatetracyclo[10.3.1.05,14.08,13]hexadeca-8,10,12-trien-9-yl]ethanone (PubChem CID 102294970) has the molecular formula C19H24O4 and a molecular weight of 316.40 g/mol. Its IUPAC name is 1-[(1R,5S)-10-hydroxy-1,6,6-trimethyl-7,16-dioxatetracyclo[10.3.1.05,14.08,13]hexadeca-8,10,12-trien-9-yl]ethanone.
| Compound Name | 1-[(1R,5S)-10-hydroxy-1,6,6-trimethyl-7,16-dioxatetracyclo[10.3.1.05,14.08,13]hexadeca-8,10,12-trien-9-yl]ethanone |
|---|---|
| PubChem CID | 102294970 |
| Molecular Formula | C19H24O4 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | 1-[(1R,5S)-10-hydroxy-1,6,6-trimethyl-7,16-dioxatetracyclo[10.3.1.05,14.08,13]hexadeca-8,10,12-trien-9-yl]ethanone |
| SMILES | CC(=O)c1c(O)cc2c3c1OC(C)(C)[C@H]1CCC[C@](C)(CC31)O2 |
| InChI | InChI=1S/C19H24O4/c1-10(20)15-13(21)8-14-16-11-9-19(4,22-14)7-5-6-12(11)18(2,3)23-17(15)16/h8,11-12,21H,5-7,9H2,1-4H3/t11?,12-,19+/m0/s1 |
| InChIKey | VKZAXLAJKMDWMZ-YPBSHKTQSA-N |
| XLogP | 4.19 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |