C23H44O5Si — CID 102295061
methyl (2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-8-(2,2-dimethylpropanoyloxy)-2-prop-2-enyloctanoate (PubChem CID 102295061) has the molecular formula C23H44O5Si and a molecular weight of 428.69 g/mol. Its IUPAC name is methyl (2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-8-(2,2-dimethylpropanoyloxy)-2-prop-2-enyloctanoate.
| Compound Name | methyl (2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-8-(2,2-dimethylpropanoyloxy)-2-prop-2-enyloctanoate |
|---|---|
| PubChem CID | 102295061 |
| Molecular Formula | C23H44O5Si |
| Molecular Weight | 428.69 g/mol |
| Exact Mass | 428.30 |
| IUPAC Name | methyl (2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-8-(2,2-dimethylpropanoyloxy)-2-prop-2-enyloctanoate |
| SMILES | C=CC[C@H](C(=O)OC)[C@@H](CCCCCOC(=O)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H44O5Si/c1-11-15-18(20(24)26-8)19(28-29(9,10)23(5,6)7)16-13-12-14-17-27-21(25)22(2,3)4/h11,18-19H,1,12-17H2,2-10H3/t18-,19+/m0/s1 |
| InChIKey | KOZBFOYPAYUGGB-RBUKOAKNSA-N |
| XLogP | 5.89 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.69 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|