About bis[4,5-dimethyl-1,3-di(propan-2-yl)imidazol-2-ylidene]azanium
bis[4,5-dimethyl-1,3-di(propan-2-yl)imidazol-2-ylidene]azanium (PubChem CID 102295424) has the molecular formula C22H40N5+
and a molecular weight of 374.60 g/mol. Its IUPAC name is bis[4,5-dimethyl-1,3-di(propan-2-yl)imidazol-2-ylidene]azanium.
Molecular Properties
| Compound Name | bis[4,5-dimethyl-1,3-di(propan-2-yl)imidazol-2-ylidene]azanium |
| PubChem CID | 102295424 |
| Molecular Formula | C22H40N5+ |
| Molecular Weight | 374.60 g/mol |
| Exact Mass | 374.33 |
| IUPAC Name | bis[4,5-dimethyl-1,3-di(propan-2-yl)imidazol-2-ylidene]azanium |
| SMILES | Cc1c(C)n(C(C)C)c(=[N+]=c2n(C(C)C)c(C)c(C)n2C(C)C)n1C(C)C |
| InChI | InChI=1S/C22H40N5/c1-13(2)24-17(9)18(10)25(14(3)4)21(24)23-22-26(15(5)6)19(11)20(12)27(22)16(7)8/h13-16H,1-12H3/q+1 |
| InChIKey | BDNQPFYANKUVSL-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 33.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.60 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze bis[4,5-dimethyl-1,3-di(propan-2-yl)imidazol-2-ylidene]azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[4,5-dimethyl-1,3-di(propan-2-yl)imidazol-2-ylidene]azanium?
The IUPAC name of bis[4,5-dimethyl-1,3-di(propan-2-yl)imidazol-2-ylidene]azanium (CID 102295424) is bis[4,5-dimethyl-1,3-di(propan-2-yl)imidazol-2-ylidene]azanium.
What is the SMILES notation for bis[4,5-dimethyl-1,3-di(propan-2-yl)imidazol-2-ylidene]azanium?
The canonical SMILES for bis[4,5-dimethyl-1,3-di(propan-2-yl)imidazol-2-ylidene]azanium is Cc1c(C)n(C(C)C)c(=[N+]=c2n(C(C)C)c(C)c(C)n2C(C)C)n1C(C)C.
What is the InChIKey of bis[4,5-dimethyl-1,3-di(propan-2-yl)imidazol-2-ylidene]azanium?
The InChIKey is BDNQPFYANKUVSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H40N5/c1-13(2)24-17(9)18(10)25(14(3)4)21(24)23-22-26(15(5)6)19(11)20(12)27(22)16(7)8/h13-16H,1-12H3/q+1.
What are the key properties of bis[4,5-dimethyl-1,3-di(propan-2-yl)imidazol-2-ylidene]azanium?
bis[4,5-dimethyl-1,3-di(propan-2-yl)imidazol-2-ylidene]azanium has a molecular weight of 374.60 g/mol, XLogP of 4.02, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis[4,5-dimethyl-1,3-di(propan-2-yl)imidazol-2-ylidene]azanium is sourced from PubChem (CID 102295424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).