C30H56N5+ — CID 102295426
bis[1,3-bis(2,2-dimethylpropyl)-4,5-dimethylimidazol-2-ylidene]azanium (PubChem CID 102295426) has the molecular formula C30H56N5+ and a molecular weight of 486.81 g/mol. Its IUPAC name is bis[1,3-bis(2,2-dimethylpropyl)-4,5-dimethylimidazol-2-ylidene]azanium.
| Compound Name | bis[1,3-bis(2,2-dimethylpropyl)-4,5-dimethylimidazol-2-ylidene]azanium |
|---|---|
| PubChem CID | 102295426 |
| Molecular Formula | C30H56N5+ |
| Molecular Weight | 486.81 g/mol |
| Exact Mass | 486.45 |
| IUPAC Name | bis[1,3-bis(2,2-dimethylpropyl)-4,5-dimethylimidazol-2-ylidene]azanium |
| SMILES | Cc1c(C)n(CC(C)(C)C)c(=[N+]=c2n(CC(C)(C)C)c(C)c(C)n2CC(C)(C)C)n1CC(C)(C)C |
| InChI | InChI=1S/C30H56N5/c1-21-22(2)33(18-28(8,9)10)25(32(21)17-27(5,6)7)31-26-34(19-29(11,12)13)23(3)24(4)35(26)20-30(14,15)16/h17-20H2,1-16H3/q+1 |
| InChIKey | WTTZIHPWSZOJBK-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 33.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.81 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|