C16H27BrO3 — CID 102295948
(1R,3S,8R,11R,14R)-14-bromo-1,13,13-trimethyl-2,7,12-trioxatricyclo[9.5.0.03,8]hexadecane (PubChem CID 102295948) has the molecular formula C16H27BrO3 and a molecular weight of 347.29 g/mol. Its IUPAC name is (1R,3S,8R,11R,14R)-14-bromo-1,13,13-trimethyl-2,7,12-trioxatricyclo[9.5.0.03,8]hexadecane.
| Compound Name | (1R,3S,8R,11R,14R)-14-bromo-1,13,13-trimethyl-2,7,12-trioxatricyclo[9.5.0.03,8]hexadecane |
|---|---|
| PubChem CID | 102295948 |
| Molecular Formula | C16H27BrO3 |
| Molecular Weight | 347.29 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | (1R,3S,8R,11R,14R)-14-bromo-1,13,13-trimethyl-2,7,12-trioxatricyclo[9.5.0.03,8]hexadecane |
| SMILES | CC1(C)O[C@@H]2CC[C@H]3OCCC[C@@H]3O[C@]2(C)CC[C@H]1Br |
| InChI | InChI=1S/C16H27BrO3/c1-15(2)13(17)8-9-16(3)14(20-15)7-6-11-12(19-16)5-4-10-18-11/h11-14H,4-10H2,1-3H3/t11-,12+,13-,14-,16-/m1/s1 |
| InChIKey | IPLCOFHFWYAIDR-JTTNIQEDSA-N |
| XLogP | 3.82 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.29 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|