C23H25NS2 — CID 102295960
3,4-bis(2,5-dimethylthiophen-3-yl)-1-(4-methylphenyl)-2,5-dihydropyrrole (PubChem CID 102295960) has the molecular formula C23H25NS2 and a molecular weight of 379.59 g/mol. Its IUPAC name is 3,4-bis(2,5-dimethylthiophen-3-yl)-1-(4-methylphenyl)-2,5-dihydropyrrole.
| Compound Name | 3,4-bis(2,5-dimethylthiophen-3-yl)-1-(4-methylphenyl)-2,5-dihydropyrrole |
|---|---|
| PubChem CID | 102295960 |
| Molecular Formula | C23H25NS2 |
| Molecular Weight | 379.59 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | 3,4-bis(2,5-dimethylthiophen-3-yl)-1-(4-methylphenyl)-2,5-dihydropyrrole |
| SMILES | Cc1ccc(N2CC(c3cc(C)sc3C)=C(c3cc(C)sc3C)C2)cc1 |
| InChI | InChI=1S/C23H25NS2/c1-14-6-8-19(9-7-14)24-12-22(20-10-15(2)25-17(20)4)23(13-24)21-11-16(3)26-18(21)5/h6-11H,12-13H2,1-5H3 |
| InChIKey | VSMOJYWTQCNQSR-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.59 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|