C16H24O3 — CID 102296144
2-(4-methylpent-3-enyl)-2-(3-oxobutyl)cyclohexane-1,3-dione (PubChem CID 102296144) has the molecular formula C16H24O3 and a molecular weight of 264.36 g/mol. Its IUPAC name is 2-(4-methylpent-3-enyl)-2-(3-oxobutyl)cyclohexane-1,3-dione.
| Compound Name | 2-(4-methylpent-3-enyl)-2-(3-oxobutyl)cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 102296144 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.36 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | 2-(4-methylpent-3-enyl)-2-(3-oxobutyl)cyclohexane-1,3-dione |
| SMILES | CC(=O)CCC1(CCC=C(C)C)C(=O)CCCC1=O |
| InChI | InChI=1S/C16H24O3/c1-12(2)6-5-10-16(11-9-13(3)17)14(18)7-4-8-15(16)19/h6H,4-5,7-11H2,1-3H3 |
| InChIKey | FUMFGGUQHJFPQN-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.36 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|