C17H28O3 — CID 102296580
2-[(4'aS,8'R,8'aS)-8',8'a-dimethylspiro[1,3-dioxolane-2,3'-4,4a,5,6,7,8-hexahydronaphthalene]-2'-yl]propan-2-ol (PubChem CID 102296580) has the molecular formula C17H28O3 and a molecular weight of 280.41 g/mol. Its IUPAC name is 2-[(4'aS,8'R,8'aS)-8',8'a-dimethylspiro[1,3-dioxolane-2,3'-4,4a,5,6,7,8-hexahydronaphthalene]-2'-yl]propan-2-ol.
| Compound Name | 2-[(4'aS,8'R,8'aS)-8',8'a-dimethylspiro[1,3-dioxolane-2,3'-4,4a,5,6,7,8-hexahydronaphthalene]-2'-yl]propan-2-ol |
|---|---|
| PubChem CID | 102296580 |
| Molecular Formula | C17H28O3 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | 2-[(4'aS,8'R,8'aS)-8',8'a-dimethylspiro[1,3-dioxolane-2,3'-4,4a,5,6,7,8-hexahydronaphthalene]-2'-yl]propan-2-ol |
| SMILES | C[C@@H]1CCC[C@H]2CC3(OCCO3)C(C(C)(C)O)=C[C@]21C |
| InChI | InChI=1S/C17H28O3/c1-12-6-5-7-13-10-17(19-8-9-20-17)14(15(2,3)18)11-16(12,13)4/h11-13,18H,5-10H2,1-4H3/t12-,13+,16+/m1/s1 |
| InChIKey | PMIVPLWJNQODIR-WWGRRREGSA-N |
| XLogP | 3.27 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|