C29H31FN4O2S — CID 10229702
7-fluoro-2-methyl-N-[(2-naphthalen-1-ylsulfonyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-7-yl)methyl]quinolin-4-amine (PubChem CID 10229702) has the molecular formula C29H31FN4O2S and a molecular weight of 518.66 g/mol. Its IUPAC name is 7-fluoro-2-methyl-N-[(2-naphthalen-1-ylsulfonyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-7-yl)methyl]quinolin-4-amine.
| Compound Name | 7-fluoro-2-methyl-N-[(2-naphthalen-1-ylsulfonyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-7-yl)methyl]quinolin-4-amine |
|---|---|
| PubChem CID | 10229702 |
| Molecular Formula | C29H31FN4O2S |
| Molecular Weight | 518.66 g/mol |
| Exact Mass | 518.22 |
| IUPAC Name | 7-fluoro-2-methyl-N-[(2-naphthalen-1-ylsulfonyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-7-yl)methyl]quinolin-4-amine |
| SMILES | Cc1cc(NCC2CCC3CN(S(=O)(=O)c4cccc5ccccc45)CCN3C2)c2ccc(F)cc2n1 |
| InChI | InChI=1S/C29H31FN4O2S/c1-20-15-27(26-12-10-23(30)16-28(26)32-20)31-17-21-9-11-24-19-34(14-13-33(24)18-21)37(35,36)29-8-4-6-22-5-2-3-7-25(22)29/h2-8,10,12,15-16,21,24H,9,11,13-14,17-19H2,1H3,(H,31,32) |
| InChIKey | OUXXUBRYPZQHHH-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.66 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |