C18H18N2 — CID 102297051
2-methyl-8-phenyl-3,4-dihydro-1H-pyrazino[1,2-a]indole (PubChem CID 102297051) has the molecular formula C18H18N2 and a molecular weight of 262.36 g/mol. Its IUPAC name is 2-methyl-8-phenyl-3,4-dihydro-1H-pyrazino[1,2-a]indole.
| Compound Name | 2-methyl-8-phenyl-3,4-dihydro-1H-pyrazino[1,2-a]indole |
|---|---|
| PubChem CID | 102297051 |
| Molecular Formula | C18H18N2 |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | 2-methyl-8-phenyl-3,4-dihydro-1H-pyrazino[1,2-a]indole |
| SMILES | CN1CCn2c(cc3cc(-c4ccccc4)ccc32)C1 |
| InChI | InChI=1S/C18H18N2/c1-19-9-10-20-17(13-19)12-16-11-15(7-8-18(16)20)14-5-3-2-4-6-14/h2-8,11-12H,9-10,13H2,1H3 |
| InChIKey | KSOVVICKBLNOAM-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |