C22H34O4 — CID 102297278
(2,4,5-trimethoxy-3-propan-2-ylphenyl)-(2,6,6-trimethylcyclohexen-1-yl)methanol (PubChem CID 102297278) has the molecular formula C22H34O4 and a molecular weight of 362.51 g/mol. Its IUPAC name is (2,4,5-trimethoxy-3-propan-2-ylphenyl)-(2,6,6-trimethylcyclohexen-1-yl)methanol.
| Compound Name | (2,4,5-trimethoxy-3-propan-2-ylphenyl)-(2,6,6-trimethylcyclohexen-1-yl)methanol |
|---|---|
| PubChem CID | 102297278 |
| Molecular Formula | C22H34O4 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.25 |
| IUPAC Name | (2,4,5-trimethoxy-3-propan-2-ylphenyl)-(2,6,6-trimethylcyclohexen-1-yl)methanol |
| SMILES | COc1cc(C(O)C2=C(C)CCCC2(C)C)c(OC)c(C(C)C)c1OC |
| InChI | InChI=1S/C22H34O4/c1-13(2)17-20(25-7)15(12-16(24-6)21(17)26-8)19(23)18-14(3)10-9-11-22(18,4)5/h12-13,19,23H,9-11H2,1-8H3 |
| InChIKey | IPQBLTXUAYRUMM-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|