C16H22O2S — CID 102297346
(4E,6E)-8-(benzenesulfinyl)-2,2-dimethylocta-4,6-dien-3-ol (PubChem CID 102297346) has the molecular formula C16H22O2S and a molecular weight of 278.42 g/mol. Its IUPAC name is (4E,6E)-8-(benzenesulfinyl)-2,2-dimethylocta-4,6-dien-3-ol.
| Compound Name | (4E,6E)-8-(benzenesulfinyl)-2,2-dimethylocta-4,6-dien-3-ol |
|---|---|
| PubChem CID | 102297346 |
| Molecular Formula | C16H22O2S |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | (4E,6E)-8-(benzenesulfinyl)-2,2-dimethylocta-4,6-dien-3-ol |
| SMILES | CC(C)(C)C(O)/C=C/C=C/CS(=O)c1ccccc1 |
| InChI | InChI=1S/C16H22O2S/c1-16(2,3)15(17)12-8-5-9-13-19(18)14-10-6-4-7-11-14/h4-12,15,17H,13H2,1-3H3/b9-5+,12-8+ |
| InChIKey | PNALFEBAPWAOGD-PIHCAMFYSA-N |
| XLogP | 3.31 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|