About 8-but-3-ynyl-1,3-bis(cyclohexylmethyl)-7H-purine-2,6-dione
8-but-3-ynyl-1,3-bis(cyclohexylmethyl)-7H-purine-2,6-dione (PubChem CID 102297585) has the molecular formula C23H32N4O2
and a molecular weight of 396.54 g/mol. Its IUPAC name is 8-but-3-ynyl-1,3-bis(cyclohexylmethyl)-7H-purine-2,6-dione.
Molecular Properties
| Compound Name | 8-but-3-ynyl-1,3-bis(cyclohexylmethyl)-7H-purine-2,6-dione |
| PubChem CID | 102297585 |
| Molecular Formula | C23H32N4O2 |
| Molecular Weight | 396.54 g/mol |
| Exact Mass | 396.25 |
| IUPAC Name | 8-but-3-ynyl-1,3-bis(cyclohexylmethyl)-7H-purine-2,6-dione |
| SMILES | C#CCCc1nc2c([nH]1)c(=O)n(CC1CCCCC1)c(=O)n2CC1CCCCC1 |
| InChI | InChI=1S/C23H32N4O2/c1-2-3-14-19-24-20-21(25-19)26(15-17-10-6-4-7-11-17)23(29)27(22(20)28)16-18-12-8-5-9-13-18/h1,17-18H,3-16H2,(H,24,25) |
| InChIKey | RQBVEWOFSRXPOX-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 72.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.54 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 8-but-3-ynyl-1,3-bis(cyclohexylmethyl)-7H-purine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-but-3-ynyl-1,3-bis(cyclohexylmethyl)-7H-purine-2,6-dione?
The IUPAC name of 8-but-3-ynyl-1,3-bis(cyclohexylmethyl)-7H-purine-2,6-dione (CID 102297585) is 8-but-3-ynyl-1,3-bis(cyclohexylmethyl)-7H-purine-2,6-dione.
What is the SMILES notation for 8-but-3-ynyl-1,3-bis(cyclohexylmethyl)-7H-purine-2,6-dione?
The canonical SMILES for 8-but-3-ynyl-1,3-bis(cyclohexylmethyl)-7H-purine-2,6-dione is C#CCCc1nc2c([nH]1)c(=O)n(CC1CCCCC1)c(=O)n2CC1CCCCC1.
What is the InChIKey of 8-but-3-ynyl-1,3-bis(cyclohexylmethyl)-7H-purine-2,6-dione?
The InChIKey is RQBVEWOFSRXPOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H32N4O2/c1-2-3-14-19-24-20-21(25-19)26(15-17-10-6-4-7-11-17)23(29)27(22(20)28)16-18-12-8-5-9-13-18/h1,17-18H,3-16H2,(H,24,25).
What are the key properties of 8-but-3-ynyl-1,3-bis(cyclohexylmethyl)-7H-purine-2,6-dione?
8-but-3-ynyl-1,3-bis(cyclohexylmethyl)-7H-purine-2,6-dione has a molecular weight of 396.54 g/mol, XLogP of 3.61, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-but-3-ynyl-1,3-bis(cyclohexylmethyl)-7H-purine-2,6-dione is sourced from PubChem (CID 102297585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).