About methyl 6-(3-aminophenyl)-2-hydroxy-3,4-dimethylbenzoate
methyl 6-(3-aminophenyl)-2-hydroxy-3,4-dimethylbenzoate (PubChem CID 102297849) has the molecular formula C16H17NO3
and a molecular weight of 271.32 g/mol. Its IUPAC name is methyl 6-(3-aminophenyl)-2-hydroxy-3,4-dimethylbenzoate.
Molecular Properties
| Compound Name | methyl 6-(3-aminophenyl)-2-hydroxy-3,4-dimethylbenzoate |
| PubChem CID | 102297849 |
| Molecular Formula | C16H17NO3 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | methyl 6-(3-aminophenyl)-2-hydroxy-3,4-dimethylbenzoate |
| SMILES | COC(=O)c1c(-c2cccc(N)c2)cc(C)c(C)c1O |
| InChI | InChI=1S/C16H17NO3/c1-9-7-13(11-5-4-6-12(17)8-11)14(16(19)20-3)15(18)10(9)2/h4-8,18H,17H2,1-3H3 |
| InChIKey | MTCIXJIQBPWHCO-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze methyl 6-(3-aminophenyl)-2-hydroxy-3,4-dimethylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-(3-aminophenyl)-2-hydroxy-3,4-dimethylbenzoate?
The IUPAC name of methyl 6-(3-aminophenyl)-2-hydroxy-3,4-dimethylbenzoate (CID 102297849) is methyl 6-(3-aminophenyl)-2-hydroxy-3,4-dimethylbenzoate.
What is the SMILES notation for methyl 6-(3-aminophenyl)-2-hydroxy-3,4-dimethylbenzoate?
The canonical SMILES for methyl 6-(3-aminophenyl)-2-hydroxy-3,4-dimethylbenzoate is COC(=O)c1c(-c2cccc(N)c2)cc(C)c(C)c1O.
What is the InChIKey of methyl 6-(3-aminophenyl)-2-hydroxy-3,4-dimethylbenzoate?
The InChIKey is MTCIXJIQBPWHCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17NO3/c1-9-7-13(11-5-4-6-12(17)8-11)14(16(19)20-3)15(18)10(9)2/h4-8,18H,17H2,1-3H3.
What are the key properties of methyl 6-(3-aminophenyl)-2-hydroxy-3,4-dimethylbenzoate?
methyl 6-(3-aminophenyl)-2-hydroxy-3,4-dimethylbenzoate has a molecular weight of 271.32 g/mol, XLogP of 3.04, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-(3-aminophenyl)-2-hydroxy-3,4-dimethylbenzoate is sourced from PubChem (CID 102297849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).