C13H15FN2OS — CID 102297902
(4R,4aS,8aS)-4-(4-fluorophenyl)-1,3,4,4a,5,6,7,8a-octahydropyrano[2,3-d]pyrimidine-2-thione (PubChem CID 102297902) has the molecular formula C13H15FN2OS and a molecular weight of 266.34 g/mol. Its IUPAC name is (4R,4aS,8aS)-4-(4-fluorophenyl)-1,3,4,4a,5,6,7,8a-octahydropyrano[2,3-d]pyrimidine-2-thione.
| Compound Name | (4R,4aS,8aS)-4-(4-fluorophenyl)-1,3,4,4a,5,6,7,8a-octahydropyrano[2,3-d]pyrimidine-2-thione |
|---|---|
| PubChem CID | 102297902 |
| Molecular Formula | C13H15FN2OS |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | (4R,4aS,8aS)-4-(4-fluorophenyl)-1,3,4,4a,5,6,7,8a-octahydropyrano[2,3-d]pyrimidine-2-thione |
| SMILES | Fc1ccc([C@@H]2NC(=S)N[C@H]3OCCC[C@H]32)cc1 |
| InChI | InChI=1S/C13H15FN2OS/c14-9-5-3-8(4-6-9)11-10-2-1-7-17-12(10)16-13(18)15-11/h3-6,10-12H,1-2,7H2,(H2,15,16,18)/t10-,11-,12-/m0/s1 |
| InChIKey | CDCHQFKUMDOREB-SRVKXCTJSA-N |
| XLogP | 2.10 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|