C26H31BSi — CID 102297931
[1,1-bis(ethenyl)-4-ethyl-2,5-diphenylsilol-3-yl]-diethylborane (PubChem CID 102297931) has the molecular formula C26H31BSi and a molecular weight of 382.43 g/mol. Its IUPAC name is [1,1-bis(ethenyl)-4-ethyl-2,5-diphenylsilol-3-yl]-diethylborane.
| Compound Name | [1,1-bis(ethenyl)-4-ethyl-2,5-diphenylsilol-3-yl]-diethylborane |
|---|---|
| PubChem CID | 102297931 |
| Molecular Formula | C26H31BSi |
| Molecular Weight | 382.43 g/mol |
| Exact Mass | 382.23 |
| IUPAC Name | [1,1-bis(ethenyl)-4-ethyl-2,5-diphenylsilol-3-yl]-diethylborane |
| SMILES | C=C[Si]1(C=C)C(c2ccccc2)=C(CC)C(B(CC)CC)=C1c1ccccc1 |
| InChI | InChI=1S/C26H31BSi/c1-6-23-24(27(7-2)8-3)26(22-19-15-12-16-20-22)28(9-4,10-5)25(23)21-17-13-11-14-18-21/h9-20H,4-8H2,1-3H3 |
| InChIKey | VUPPLQSAJVECKN-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.43 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|