C24H19F8NO3 — CID 10229808
1,1,1-trifluoro-3-[3-(4-fluorophenoxy)-N-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]anilino]propan-2-ol (PubChem CID 10229808) has the molecular formula C24H19F8NO3 and a molecular weight of 521.40 g/mol. Its IUPAC name is 1,1,1-trifluoro-3-[3-(4-fluorophenoxy)-N-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]anilino]propan-2-ol.
| Compound Name | 1,1,1-trifluoro-3-[3-(4-fluorophenoxy)-N-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]anilino]propan-2-ol |
|---|---|
| PubChem CID | 10229808 |
| Molecular Formula | C24H19F8NO3 |
| Molecular Weight | 521.40 g/mol |
| Exact Mass | 521.12 |
| IUPAC Name | 1,1,1-trifluoro-3-[3-(4-fluorophenoxy)-N-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]anilino]propan-2-ol |
| SMILES | OC(CN(Cc1cccc(OC(F)(F)C(F)F)c1)c1cccc(Oc2ccc(F)cc2)c1)C(F)(F)F |
| InChI | InChI=1S/C24H19F8NO3/c25-16-7-9-18(10-8-16)35-19-5-2-4-17(12-19)33(14-21(34)23(28,29)30)13-15-3-1-6-20(11-15)36-24(31,32)22(26)27/h1-12,21-22,34H,13-14H2 |
| InChIKey | ZHUQKYBEVUVRAV-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.40 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|