C17H24OS — CID 102298303
(2S,3aS,8aR)-2-(phenylsulfanylmethyl)-2,3,4,5,6,7,8,8a-octahydro-1H-azulen-3a-ol (PubChem CID 102298303) has the molecular formula C17H24OS and a molecular weight of 276.44 g/mol. Its IUPAC name is (2S,3aS,8aR)-2-(phenylsulfanylmethyl)-2,3,4,5,6,7,8,8a-octahydro-1H-azulen-3a-ol.
| Compound Name | (2S,3aS,8aR)-2-(phenylsulfanylmethyl)-2,3,4,5,6,7,8,8a-octahydro-1H-azulen-3a-ol |
|---|---|
| PubChem CID | 102298303 |
| Molecular Formula | C17H24OS |
| Molecular Weight | 276.44 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | (2S,3aS,8aR)-2-(phenylsulfanylmethyl)-2,3,4,5,6,7,8,8a-octahydro-1H-azulen-3a-ol |
| SMILES | O[C@]12CCCCC[C@@H]1C[C@H](CSc1ccccc1)C2 |
| InChI | InChI=1S/C17H24OS/c18-17-10-6-2-3-7-15(17)11-14(12-17)13-19-16-8-4-1-5-9-16/h1,4-5,8-9,14-15,18H,2-3,6-7,10-13H2/t14-,15+,17-/m0/s1 |
| InChIKey | GEWVFPOBZVKIKF-UXLLHSPISA-N |
| XLogP | 4.50 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.44 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |