About 4-[(5-chlorothiophen-2-yl)methyl]-4-methyl-1,3-dihydroisochromene
4-[(5-chlorothiophen-2-yl)methyl]-4-methyl-1,3-dihydroisochromene (PubChem CID 102298325) has the molecular formula C15H15ClOS
and a molecular weight of 278.80 g/mol. Its IUPAC name is 4-[(5-chlorothiophen-2-yl)methyl]-4-methyl-1,3-dihydroisochromene.
Molecular Properties
| Compound Name | 4-[(5-chlorothiophen-2-yl)methyl]-4-methyl-1,3-dihydroisochromene |
| PubChem CID | 102298325 |
| Molecular Formula | C15H15ClOS |
| Molecular Weight | 278.80 g/mol |
| Exact Mass | 278.05 |
| IUPAC Name | 4-[(5-chlorothiophen-2-yl)methyl]-4-methyl-1,3-dihydroisochromene |
| SMILES | CC1(Cc2ccc(Cl)s2)COCc2ccccc21 |
| InChI | InChI=1S/C15H15ClOS/c1-15(8-12-6-7-14(16)18-12)10-17-9-11-4-2-3-5-13(11)15/h2-7H,8-10H2,1H3 |
| InChIKey | QQUXAFAOOSJFHW-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.80 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[(5-chlorothiophen-2-yl)methyl]-4-methyl-1,3-dihydroisochromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(5-chlorothiophen-2-yl)methyl]-4-methyl-1,3-dihydroisochromene?
The IUPAC name of 4-[(5-chlorothiophen-2-yl)methyl]-4-methyl-1,3-dihydroisochromene (CID 102298325) is 4-[(5-chlorothiophen-2-yl)methyl]-4-methyl-1,3-dihydroisochromene.
What is the SMILES notation for 4-[(5-chlorothiophen-2-yl)methyl]-4-methyl-1,3-dihydroisochromene?
The canonical SMILES for 4-[(5-chlorothiophen-2-yl)methyl]-4-methyl-1,3-dihydroisochromene is CC1(Cc2ccc(Cl)s2)COCc2ccccc21.
What is the InChIKey of 4-[(5-chlorothiophen-2-yl)methyl]-4-methyl-1,3-dihydroisochromene?
The InChIKey is QQUXAFAOOSJFHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15ClOS/c1-15(8-12-6-7-14(16)18-12)10-17-9-11-4-2-3-5-13(11)15/h2-7H,8-10H2,1H3.
What are the key properties of 4-[(5-chlorothiophen-2-yl)methyl]-4-methyl-1,3-dihydroisochromene?
4-[(5-chlorothiophen-2-yl)methyl]-4-methyl-1,3-dihydroisochromene has a molecular weight of 278.80 g/mol, XLogP of 4.43, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(5-chlorothiophen-2-yl)methyl]-4-methyl-1,3-dihydroisochromene is sourced from PubChem (CID 102298325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).