C26H40O2 — CID 102298549
(4aR,6S,7R)-7-methyl-4a,6-bis(3-methylbut-2-enyl)-7-(4-methylpent-3-enyl)-3,4,5,6-tetrahydrochromen-2-one (PubChem CID 102298549) has the molecular formula C26H40O2 and a molecular weight of 384.60 g/mol. Its IUPAC name is (4aR,6S,7R)-7-methyl-4a,6-bis(3-methylbut-2-enyl)-7-(4-methylpent-3-enyl)-3,4,5,6-tetrahydrochromen-2-one.
| Compound Name | (4aR,6S,7R)-7-methyl-4a,6-bis(3-methylbut-2-enyl)-7-(4-methylpent-3-enyl)-3,4,5,6-tetrahydrochromen-2-one |
|---|---|
| PubChem CID | 102298549 |
| Molecular Formula | C26H40O2 |
| Molecular Weight | 384.60 g/mol |
| Exact Mass | 384.30 |
| IUPAC Name | (4aR,6S,7R)-7-methyl-4a,6-bis(3-methylbut-2-enyl)-7-(4-methylpent-3-enyl)-3,4,5,6-tetrahydrochromen-2-one |
| SMILES | CC(C)=CCC[C@@]1(C)C=C2OC(=O)CC[C@@]2(CC=C(C)C)C[C@@H]1CC=C(C)C |
| InChI | InChI=1S/C26H40O2/c1-19(2)9-8-14-25(7)18-23-26(15-12-21(5)6,16-13-24(27)28-23)17-22(25)11-10-20(3)4/h9-10,12,18,22H,8,11,13-17H2,1-7H3/t22-,25-,26-/m0/s1 |
| InChIKey | RTLJELKQTADVOI-HRNNMHKYSA-N |
| XLogP | 7.68 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.60 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|