About lithium (E)-1,3-dimethoxy-3-oxoprop-1-en-1-olate
lithium (E)-1,3-dimethoxy-3-oxoprop-1-en-1-olate (PubChem CID 102298729) has the molecular formula C5H7LiO4
and a molecular weight of 138.05 g/mol. Its IUPAC name is lithium (E)-1,3-dimethoxy-3-oxoprop-1-en-1-olate.
Molecular Properties
| Compound Name | lithium (E)-1,3-dimethoxy-3-oxoprop-1-en-1-olate |
| PubChem CID | 102298729 |
| Molecular Formula | C5H7LiO4 |
| Molecular Weight | 138.05 g/mol |
| Exact Mass | 138.05 |
| IUPAC Name | lithium (E)-1,3-dimethoxy-3-oxoprop-1-en-1-olate |
| SMILES | COC(=O)/C=C(\[O-])OC.[Li+] |
| InChI | InChI=1S/C5H8O4.Li/c1-8-4(6)3-5(7)9-2;/h3,6H,1-2H3;/q;+1/p-1/b4-3+; |
| InChIKey | GNJZXFMDRHAMOM-BJILWQEISA-M |
| XLogP | -3.99 |
| TPSA | 58.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.05 |
| LogP ≤ 5 | -3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze lithium (E)-1,3-dimethoxy-3-oxoprop-1-en-1-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium (E)-1,3-dimethoxy-3-oxoprop-1-en-1-olate?
The IUPAC name of lithium (E)-1,3-dimethoxy-3-oxoprop-1-en-1-olate (CID 102298729) is lithium (E)-1,3-dimethoxy-3-oxoprop-1-en-1-olate.
What is the SMILES notation for lithium (E)-1,3-dimethoxy-3-oxoprop-1-en-1-olate?
The canonical SMILES for lithium (E)-1,3-dimethoxy-3-oxoprop-1-en-1-olate is COC(=O)/C=C(\[O-])OC.[Li+].
What is the InChIKey of lithium (E)-1,3-dimethoxy-3-oxoprop-1-en-1-olate?
The InChIKey is GNJZXFMDRHAMOM-BJILWQEISA-M. The full InChI is InChI=1S/C5H8O4.Li/c1-8-4(6)3-5(7)9-2;/h3,6H,1-2H3;/q;+1/p-1/b4-3+;.
What are the key properties of lithium (E)-1,3-dimethoxy-3-oxoprop-1-en-1-olate?
lithium (E)-1,3-dimethoxy-3-oxoprop-1-en-1-olate has a molecular weight of 138.05 g/mol, XLogP of -3.99, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for lithium (E)-1,3-dimethoxy-3-oxoprop-1-en-1-olate is sourced from PubChem (CID 102298729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).