C26H28BrFN6 — CID 10229900
6-bromo-N-butyl-3-[2-(cyclopentylamino)pyrimidin-4-yl]-2-(4-fluorophenyl)imidazo[1,2-a]pyridin-8-amine (PubChem CID 10229900) has the molecular formula C26H28BrFN6 and a molecular weight of 523.45 g/mol. Its IUPAC name is 6-bromo-N-butyl-3-[2-(cyclopentylamino)pyrimidin-4-yl]-2-(4-fluorophenyl)imidazo[1,2-a]pyridin-8-amine.
| Compound Name | 6-bromo-N-butyl-3-[2-(cyclopentylamino)pyrimidin-4-yl]-2-(4-fluorophenyl)imidazo[1,2-a]pyridin-8-amine |
|---|---|
| PubChem CID | 10229900 |
| Molecular Formula | C26H28BrFN6 |
| Molecular Weight | 523.45 g/mol |
| Exact Mass | 522.15 |
| IUPAC Name | 6-bromo-N-butyl-3-[2-(cyclopentylamino)pyrimidin-4-yl]-2-(4-fluorophenyl)imidazo[1,2-a]pyridin-8-amine |
| SMILES | CCCCNc1cc(Br)cn2c(-c3ccnc(NC4CCCC4)n3)c(-c3ccc(F)cc3)nc12 |
| InChI | InChI=1S/C26H28BrFN6/c1-2-3-13-29-22-15-18(27)16-34-24(23(33-25(22)34)17-8-10-19(28)11-9-17)21-12-14-30-26(32-21)31-20-6-4-5-7-20/h8-12,14-16,20,29H,2-7,13H2,1H3,(H,30,31,32) |
| InChIKey | PXKQLJBZGIJPDM-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 67.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.45 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|