C35H62O — CID 102299183
(18Z)-2,6,10,14,18-pentamethyl-22-(4-methylcyclohex-3-en-1-yl)tricosa-18,22-dien-11-one (PubChem CID 102299183) has the molecular formula C35H62O and a molecular weight of 498.88 g/mol. Its IUPAC name is (18Z)-2,6,10,14,18-pentamethyl-22-(4-methylcyclohex-3-en-1-yl)tricosa-18,22-dien-11-one.
| Compound Name | (18Z)-2,6,10,14,18-pentamethyl-22-(4-methylcyclohex-3-en-1-yl)tricosa-18,22-dien-11-one |
|---|---|
| PubChem CID | 102299183 |
| Molecular Formula | C35H62O |
| Molecular Weight | 498.88 g/mol |
| Exact Mass | 498.48 |
| IUPAC Name | (18Z)-2,6,10,14,18-pentamethyl-22-(4-methylcyclohex-3-en-1-yl)tricosa-18,22-dien-11-one |
| SMILES | C=C(CC/C=C(/C)CCCC(C)CCC(=O)C(C)CCCC(C)CCCC(C)C)C1CC=C(C)CC1 |
| InChI | InChI=1S/C35H62O/c1-27(2)13-9-14-28(3)18-12-20-33(8)35(36)26-23-30(5)16-10-15-29(4)17-11-19-32(7)34-24-21-31(6)22-25-34/h17,21,27-28,30,33-34H,7,9-16,18-20,22-26H2,1-6,8H3/b29-17- |
| InChIKey | BXWWQVYVQNHUMW-RHANQZHGSA-N |
| XLogP | 11.44 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.88 |
| LogP ≤ 5 | 11.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|