C20H28O5 — CID 102299195
diethyl (3Z,3aS,6aR)-3-(5-oxohexan-2-ylidene)-2,3a,6,6a-tetrahydropentalene-1,1-dicarboxylate (PubChem CID 102299195) has the molecular formula C20H28O5 and a molecular weight of 348.44 g/mol. Its IUPAC name is diethyl (3Z,3aS,6aR)-3-(5-oxohexan-2-ylidene)-2,3a,6,6a-tetrahydropentalene-1,1-dicarboxylate.
| Compound Name | diethyl (3Z,3aS,6aR)-3-(5-oxohexan-2-ylidene)-2,3a,6,6a-tetrahydropentalene-1,1-dicarboxylate |
|---|---|
| PubChem CID | 102299195 |
| Molecular Formula | C20H28O5 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | diethyl (3Z,3aS,6aR)-3-(5-oxohexan-2-ylidene)-2,3a,6,6a-tetrahydropentalene-1,1-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)C/C(=C(\C)CCC(C)=O)[C@H]2C=CC[C@H]21 |
| InChI | InChI=1S/C20H28O5/c1-5-24-18(22)20(19(23)25-6-2)12-16(13(3)10-11-14(4)21)15-8-7-9-17(15)20/h7-8,15,17H,5-6,9-12H2,1-4H3/b16-13-/t15-,17-/m1/s1 |
| InChIKey | IAGACTTZMZJSOP-ZRPBFWNPSA-N |
| XLogP | 3.38 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|