C9H13NO3 — CID 102299700
(3aS,7aR)-3-methylidene-3a-nitro-5,6,7,7a-tetrahydro-4H-1-benzofuran (PubChem CID 102299700) has the molecular formula C9H13NO3 and a molecular weight of 183.21 g/mol. Its IUPAC name is (3aS,7aR)-3-methylidene-3a-nitro-5,6,7,7a-tetrahydro-4H-1-benzofuran.
| Compound Name | (3aS,7aR)-3-methylidene-3a-nitro-5,6,7,7a-tetrahydro-4H-1-benzofuran |
|---|---|
| PubChem CID | 102299700 |
| Molecular Formula | C9H13NO3 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.09 |
| IUPAC Name | (3aS,7aR)-3-methylidene-3a-nitro-5,6,7,7a-tetrahydro-4H-1-benzofuran |
| SMILES | C=C1CO[C@@H]2CCCC[C@]12[N+](=O)[O-] |
| InChI | InChI=1S/C9H13NO3/c1-7-6-13-8-4-2-3-5-9(7,8)10(11)12/h8H,1-6H2/t8-,9+/m1/s1 |
| InChIKey | AKNCLVVCIIKOJO-BDAKNGLRSA-N |
| XLogP | 1.53 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|