C17H31NO7 — CID 102299806
ethyl N-[[(2R,5R,6R)-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]-ethoxymethyl]-N-prop-2-enylcarbamate (PubChem CID 102299806) has the molecular formula C17H31NO7 and a molecular weight of 361.44 g/mol. Its IUPAC name is ethyl N-[[(2R,5R,6R)-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]-ethoxymethyl]-N-prop-2-enylcarbamate.
| Compound Name | ethyl N-[[(2R,5R,6R)-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]-ethoxymethyl]-N-prop-2-enylcarbamate |
|---|---|
| PubChem CID | 102299806 |
| Molecular Formula | C17H31NO7 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.21 |
| IUPAC Name | ethyl N-[[(2R,5R,6R)-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]-ethoxymethyl]-N-prop-2-enylcarbamate |
| SMILES | C=CCN(C(=O)OCC)C(OCC)[C@H]1CO[C@@](C)(OC)[C@](C)(OC)O1 |
| InChI | InChI=1S/C17H31NO7/c1-8-11-18(15(19)23-10-3)14(22-9-2)13-12-24-16(4,20-6)17(5,21-7)25-13/h8,13-14H,1,9-12H2,2-7H3/t13-,14?,16-,17-/m1/s1 |
| InChIKey | HLWSZUZCVCYJQA-KLCSZFHISA-N |
| XLogP | 2.13 |
| TPSA | 75.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|