C24H29NO4 — CID 102300155
(2R,4aR,6S,7R,8R,8aS)-N-benzyl-6-methoxy-2-phenyl-8-prop-2-enyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-amine (PubChem CID 102300155) has the molecular formula C24H29NO4 and a molecular weight of 395.50 g/mol. Its IUPAC name is (2R,4aR,6S,7R,8R,8aS)-N-benzyl-6-methoxy-2-phenyl-8-prop-2-enyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-amine.
| Compound Name | (2R,4aR,6S,7R,8R,8aS)-N-benzyl-6-methoxy-2-phenyl-8-prop-2-enyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-amine |
|---|---|
| PubChem CID | 102300155 |
| Molecular Formula | C24H29NO4 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | (2R,4aR,6S,7R,8R,8aS)-N-benzyl-6-methoxy-2-phenyl-8-prop-2-enyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-amine |
| SMILES | C=CC[C@@H]1[C@@H](NCc2ccccc2)[C@@H](OC)O[C@@H]2CO[C@@H](c3ccccc3)O[C@@H]12 |
| InChI | InChI=1S/C24H29NO4/c1-3-10-19-21(25-15-17-11-6-4-7-12-17)24(26-2)28-20-16-27-23(29-22(19)20)18-13-8-5-9-14-18/h3-9,11-14,19-25H,1,10,15-16H2,2H3/t19-,20-,21-,22+,23-,24+/m1/s1 |
| InChIKey | VZPPJZDVOBNMPT-YWIRWFRESA-N |
| XLogP | 3.82 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|