About 1-[dichloro(ethylsulfanyl)methyl]-6,7-dimethoxy-3,4-dihydroisoquinoline
1-[dichloro(ethylsulfanyl)methyl]-6,7-dimethoxy-3,4-dihydroisoquinoline (PubChem CID 102300235) has the molecular formula C14H17Cl2NO2S
and a molecular weight of 334.27 g/mol. Its IUPAC name is 1-[dichloro(ethylsulfanyl)methyl]-6,7-dimethoxy-3,4-dihydroisoquinoline.
Molecular Properties
| Compound Name | 1-[dichloro(ethylsulfanyl)methyl]-6,7-dimethoxy-3,4-dihydroisoquinoline |
| PubChem CID | 102300235 |
| Molecular Formula | C14H17Cl2NO2S |
| Molecular Weight | 334.27 g/mol |
| Exact Mass | 333.04 |
| IUPAC Name | 1-[dichloro(ethylsulfanyl)methyl]-6,7-dimethoxy-3,4-dihydroisoquinoline |
| SMILES | CCSC(Cl)(Cl)C1=NCCc2cc(OC)c(OC)cc21 |
| InChI | InChI=1S/C14H17Cl2NO2S/c1-4-20-14(15,16)13-10-8-12(19-3)11(18-2)7-9(10)5-6-17-13/h7-8H,4-6H2,1-3H3 |
| InChIKey | GFCYJQQUVOHZRA-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.27 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-[dichloro(ethylsulfanyl)methyl]-6,7-dimethoxy-3,4-dihydroisoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[dichloro(ethylsulfanyl)methyl]-6,7-dimethoxy-3,4-dihydroisoquinoline?
The IUPAC name of 1-[dichloro(ethylsulfanyl)methyl]-6,7-dimethoxy-3,4-dihydroisoquinoline (CID 102300235) is 1-[dichloro(ethylsulfanyl)methyl]-6,7-dimethoxy-3,4-dihydroisoquinoline.
What is the SMILES notation for 1-[dichloro(ethylsulfanyl)methyl]-6,7-dimethoxy-3,4-dihydroisoquinoline?
The canonical SMILES for 1-[dichloro(ethylsulfanyl)methyl]-6,7-dimethoxy-3,4-dihydroisoquinoline is CCSC(Cl)(Cl)C1=NCCc2cc(OC)c(OC)cc21.
What is the InChIKey of 1-[dichloro(ethylsulfanyl)methyl]-6,7-dimethoxy-3,4-dihydroisoquinoline?
The InChIKey is GFCYJQQUVOHZRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17Cl2NO2S/c1-4-20-14(15,16)13-10-8-12(19-3)11(18-2)7-9(10)5-6-17-13/h7-8H,4-6H2,1-3H3.
What are the key properties of 1-[dichloro(ethylsulfanyl)methyl]-6,7-dimethoxy-3,4-dihydroisoquinoline?
1-[dichloro(ethylsulfanyl)methyl]-6,7-dimethoxy-3,4-dihydroisoquinoline has a molecular weight of 334.27 g/mol, XLogP of 3.93, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[dichloro(ethylsulfanyl)methyl]-6,7-dimethoxy-3,4-dihydroisoquinoline is sourced from PubChem (CID 102300235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).