About 2-(3,5-ditert-butylphenyl)-1-methylpyrrolidine
2-(3,5-ditert-butylphenyl)-1-methylpyrrolidine (PubChem CID 102300432) has the molecular formula C19H31N
and a molecular weight of 273.46 g/mol. Its IUPAC name is 2-(3,5-ditert-butylphenyl)-1-methylpyrrolidine.
Molecular Properties
| Compound Name | 2-(3,5-ditert-butylphenyl)-1-methylpyrrolidine |
| PubChem CID | 102300432 |
| Molecular Formula | C19H31N |
| Molecular Weight | 273.46 g/mol |
| Exact Mass | 273.25 |
| IUPAC Name | 2-(3,5-ditert-butylphenyl)-1-methylpyrrolidine |
| SMILES | CN1CCCC1c1cc(C(C)(C)C)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C19H31N/c1-18(2,3)15-11-14(17-9-8-10-20(17)7)12-16(13-15)19(4,5)6/h11-13,17H,8-10H2,1-7H3 |
| InChIKey | SZWHBNDDZMSBHG-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 273.46 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(3,5-ditert-butylphenyl)-1-methylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,5-ditert-butylphenyl)-1-methylpyrrolidine?
The IUPAC name of 2-(3,5-ditert-butylphenyl)-1-methylpyrrolidine (CID 102300432) is 2-(3,5-ditert-butylphenyl)-1-methylpyrrolidine.
What is the SMILES notation for 2-(3,5-ditert-butylphenyl)-1-methylpyrrolidine?
The canonical SMILES for 2-(3,5-ditert-butylphenyl)-1-methylpyrrolidine is CN1CCCC1c1cc(C(C)(C)C)cc(C(C)(C)C)c1.
What is the InChIKey of 2-(3,5-ditert-butylphenyl)-1-methylpyrrolidine?
The InChIKey is SZWHBNDDZMSBHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H31N/c1-18(2,3)15-11-14(17-9-8-10-20(17)7)12-16(13-15)19(4,5)6/h11-13,17H,8-10H2,1-7H3.
What are the key properties of 2-(3,5-ditert-butylphenyl)-1-methylpyrrolidine?
2-(3,5-ditert-butylphenyl)-1-methylpyrrolidine has a molecular weight of 273.46 g/mol, XLogP of 5.05, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,5-ditert-butylphenyl)-1-methylpyrrolidine is sourced from PubChem (CID 102300432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).