C25H16F4N4O5 — CID 10230097
8-[4-fluoro-3-(trifluoromethyl)benzoyl]-4-(4-nitronaphthalen-1-yl)-2,4,8-triazatricyclo[5.2.1.02,6]decane-3,5-dione (PubChem CID 10230097) has the molecular formula C25H16F4N4O5 and a molecular weight of 528.42 g/mol. Its IUPAC name is 8-[4-fluoro-3-(trifluoromethyl)benzoyl]-4-(4-nitronaphthalen-1-yl)-2,4,8-triazatricyclo[5.2.1.02,6]decane-3,5-dione.
| Compound Name | 8-[4-fluoro-3-(trifluoromethyl)benzoyl]-4-(4-nitronaphthalen-1-yl)-2,4,8-triazatricyclo[5.2.1.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 10230097 |
| Molecular Formula | C25H16F4N4O5 |
| Molecular Weight | 528.42 g/mol |
| Exact Mass | 528.11 |
| IUPAC Name | 8-[4-fluoro-3-(trifluoromethyl)benzoyl]-4-(4-nitronaphthalen-1-yl)-2,4,8-triazatricyclo[5.2.1.02,6]decane-3,5-dione |
| SMILES | O=C1C2C3CC(CN3C(=O)c3ccc(F)c(C(F)(F)F)c3)N2C(=O)N1c1ccc([N+](=O)[O-])c2ccccc12 |
| InChI | InChI=1S/C25H16F4N4O5/c26-17-6-5-12(9-16(17)25(27,28)29)22(34)30-11-13-10-20(30)21-23(35)32(24(36)31(13)21)18-7-8-19(33(37)38)15-4-2-1-3-14(15)18/h1-9,13,20-21H,10-11H2 |
| InChIKey | QDMBNEIPRSGVCQ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 104.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.42 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|