C21H26N6 — CID 102301037
2-N,4-N-bis(3,5-dimethylphenyl)-6-N-ethyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 102301037) has the molecular formula C21H26N6 and a molecular weight of 362.48 g/mol. Its IUPAC name is 2-N,4-N-bis(3,5-dimethylphenyl)-6-N-ethyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N,4-N-bis(3,5-dimethylphenyl)-6-N-ethyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 102301037 |
| Molecular Formula | C21H26N6 |
| Molecular Weight | 362.48 g/mol |
| Exact Mass | 362.22 |
| IUPAC Name | 2-N,4-N-bis(3,5-dimethylphenyl)-6-N-ethyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCNc1nc(Nc2cc(C)cc(C)c2)nc(Nc2cc(C)cc(C)c2)n1 |
| InChI | InChI=1S/C21H26N6/c1-6-22-19-25-20(23-17-9-13(2)7-14(3)10-17)27-21(26-19)24-18-11-15(4)8-16(5)12-18/h7-12H,6H2,1-5H3,(H3,22,23,24,25,26,27) |
| InChIKey | MWRCOURFPAGOTI-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 74.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.48 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |