C10H18O4 — CID 102301312
(2S)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]pent-4-ene-1,2-diol (PubChem CID 102301312) has the molecular formula C10H18O4 and a molecular weight of 202.25 g/mol. Its IUPAC name is (2S)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]pent-4-ene-1,2-diol.
| Compound Name | (2S)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]pent-4-ene-1,2-diol |
|---|---|
| PubChem CID | 102301312 |
| Molecular Formula | C10H18O4 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | (2S)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]pent-4-ene-1,2-diol |
| SMILES | C=CC[C@](O)(CO)[C@@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C10H18O4/c1-4-5-10(12,7-11)8-6-13-9(2,3)14-8/h4,8,11-12H,1,5-7H2,2-3H3/t8-,10-/m0/s1 |
| InChIKey | JSOBJSWRPFOLJV-WPRPVWTQSA-N |
| XLogP | 0.44 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|