C19H32O5 — CID 102301741
[(3Z,5R,6Z)-5-acetyloxydodeca-3,6-dienyl] 5-hydroxypentanoate (PubChem CID 102301741) has the molecular formula C19H32O5 and a molecular weight of 340.46 g/mol. Its IUPAC name is [(3Z,5R,6Z)-5-acetyloxydodeca-3,6-dienyl] 5-hydroxypentanoate.
| Compound Name | [(3Z,5R,6Z)-5-acetyloxydodeca-3,6-dienyl] 5-hydroxypentanoate |
|---|---|
| PubChem CID | 102301741 |
| Molecular Formula | C19H32O5 |
| Molecular Weight | 340.46 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | [(3Z,5R,6Z)-5-acetyloxydodeca-3,6-dienyl] 5-hydroxypentanoate |
| SMILES | CCCCC/C=C\[C@H](/C=C\CCOC(=O)CCCCO)OC(C)=O |
| InChI | InChI=1S/C19H32O5/c1-3-4-5-6-7-12-18(24-17(2)21)13-9-11-16-23-19(22)14-8-10-15-20/h7,9,12-13,18,20H,3-6,8,10-11,14-16H2,1-2H3/b12-7-,13-9-/t18-/m1/s1 |
| InChIKey | MYRBVHYJKZGAPW-SGDCSESYSA-N |
| XLogP | 3.71 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.46 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|