About CID 102302475
CID 102302475 (PubChem CID 102302475) has the molecular formula C33H49N2O3
and a molecular weight of 521.77 g/mol.
Molecular Properties
| Compound Name | CID 102302475 |
| PubChem CID | 102302475 |
| Molecular Formula | C33H49N2O3 |
| Molecular Weight | 521.77 g/mol |
| Exact Mass | 521.37 |
| IUPAC Name | — |
| SMILES | CCCCCCCCCCOc1ccc(-c2ccc(C(=O)N(C)C3CC(C)(C)N([O])C(C)(C)C3)cc2)cc1 |
| InChI | InChI=1S/C33H49N2O3/c1-7-8-9-10-11-12-13-14-23-38-30-21-19-27(20-22-30)26-15-17-28(18-16-26)31(36)34(6)29-24-32(2,3)35(37)33(4,5)25-29/h15-22,29H,7-14,23-25H2,1-6H3 |
| InChIKey | MKLMWEAOMLALLG-UHFFFAOYSA-N |
| XLogP | 8.31 |
| TPSA | 52.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 521.77 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze CID 102302475 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 102302475?
The IUPAC name of CID 102302475 (CID 102302475) is not available.
What is the SMILES notation for CID 102302475?
The canonical SMILES for CID 102302475 is CCCCCCCCCCOc1ccc(-c2ccc(C(=O)N(C)C3CC(C)(C)N([O])C(C)(C)C3)cc2)cc1.
What is the InChIKey of CID 102302475?
The InChIKey is MKLMWEAOMLALLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C33H49N2O3/c1-7-8-9-10-11-12-13-14-23-38-30-21-19-27(20-22-30)26-15-17-28(18-16-26)31(36)34(6)29-24-32(2,3)35(37)33(4,5)25-29/h15-22,29H,7-14,23-25H2,1-6H3.
What are the key properties of CID 102302475?
CID 102302475 has a molecular weight of 521.77 g/mol, XLogP of 8.31, 13 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 102302475 is sourced from PubChem (CID 102302475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).