C11H16O4 — CID 102302499
2-[(1R,4R,5S)-5-(acetyloxymethyl)-4-methylcyclopent-2-en-1-yl]acetic acid (PubChem CID 102302499) has the molecular formula C11H16O4 and a molecular weight of 212.24 g/mol. Its IUPAC name is 2-[(1R,4R,5S)-5-(acetyloxymethyl)-4-methylcyclopent-2-en-1-yl]acetic acid.
| Compound Name | 2-[(1R,4R,5S)-5-(acetyloxymethyl)-4-methylcyclopent-2-en-1-yl]acetic acid |
|---|---|
| PubChem CID | 102302499 |
| Molecular Formula | C11H16O4 |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | 2-[(1R,4R,5S)-5-(acetyloxymethyl)-4-methylcyclopent-2-en-1-yl]acetic acid |
| SMILES | CC(=O)OC[C@H]1[C@H](C)C=C[C@H]1CC(=O)O |
| InChI | InChI=1S/C11H16O4/c1-7-3-4-9(5-11(13)14)10(7)6-15-8(2)12/h3-4,7,9-10H,5-6H2,1-2H3,(H,13,14)/t7-,9+,10+/m1/s1 |
| InChIKey | HOPDTKDZSDKOTC-JEZHCXPESA-N |
| XLogP | 1.46 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|